C24H34O5S — CID 57269396
2-acetylsulfanyl-3-[(8R,9R,10R,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl]propanoic acid (PubChem CID 57269396) has the molecular formula C24H34O5S and a molecular weight of 434.60 g/mol. Its IUPAC name is 2-acetylsulfanyl-3-[(8R,9R,10R,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl]propanoic acid.
| Compound Name | 2-acetylsulfanyl-3-[(8R,9R,10R,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl]propanoic acid |
|---|---|
| PubChem CID | 57269396 |
| Molecular Formula | C24H34O5S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-acetylsulfanyl-3-[(8R,9R,10R,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl]propanoic acid |
| SMILES | CC(=O)SC(CC1CC2=CC(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(O)CC[C@H]3[C@H]12)C(=O)O |
| InChI | InChI=1S/C24H34O5S/c1-13(25)30-19(22(28)29)11-14-10-15-12-16(26)6-8-23(15,2)18-7-9-24(3)17(21(14)18)4-5-20(24)27/h12,14,17-21,27H,4-11H2,1-3H3,(H,28,29)/t14?,17-,18+,19?,20?,21-,23-,24-/m0/s1 |
| InChIKey | CKHWEHFWYNZVMZ-WRJCMCHMSA-N |
| XLogP | 4.23 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|