About 4-(1,3,5-triazin-2-yl)thiadiazole
4-(1,3,5-triazin-2-yl)thiadiazole (PubChem CID 57269439) has the molecular formula C5H3N5S
and a molecular weight of 165.18 g/mol. Its IUPAC name is 4-(1,3,5-triazin-2-yl)thiadiazole.
Molecular Properties
| Compound Name | 4-(1,3,5-triazin-2-yl)thiadiazole |
| PubChem CID | 57269439 |
| Molecular Formula | C5H3N5S |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | 4-(1,3,5-triazin-2-yl)thiadiazole |
| SMILES | c1ncnc(-c2csnn2)n1 |
| InChI | InChI=1S/C5H3N5S/c1-4(9-10-11-1)5-7-2-6-3-8-5/h1-3H |
| InChIKey | FVYDJUZYNDEPSO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,3,5-triazin-2-yl)thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3,5-triazin-2-yl)thiadiazole?
The IUPAC name of 4-(1,3,5-triazin-2-yl)thiadiazole (CID 57269439) is 4-(1,3,5-triazin-2-yl)thiadiazole.
What is the SMILES notation for 4-(1,3,5-triazin-2-yl)thiadiazole?
The canonical SMILES for 4-(1,3,5-triazin-2-yl)thiadiazole is c1ncnc(-c2csnn2)n1.
What is the InChIKey of 4-(1,3,5-triazin-2-yl)thiadiazole?
The InChIKey is FVYDJUZYNDEPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N5S/c1-4(9-10-11-1)5-7-2-6-3-8-5/h1-3H.
What are the key properties of 4-(1,3,5-triazin-2-yl)thiadiazole?
4-(1,3,5-triazin-2-yl)thiadiazole has a molecular weight of 165.18 g/mol, XLogP of 0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,5-triazin-2-yl)thiadiazole is sourced from PubChem (CID 57269439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).