C33H46N2O6 — CID 57269667
(2R,3S,4S,5R)-5-N-benzyl-3,4-bis(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine (PubChem CID 57269667) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-N-benzyl-3,4-bis(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine.
| Compound Name | (2R,3S,4S,5R)-5-N-benzyl-3,4-bis(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine |
|---|---|
| PubChem CID | 57269667 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | (2R,3S,4S,5R)-5-N-benzyl-3,4-bis(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine |
| SMILES | COCCOCO[C@H]([C@@H](OCOCCOC)[C@@H](Cc1ccccc1)NCc1ccccc1)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C33H46N2O6/c1-36-18-20-38-25-40-32(30(34)22-27-12-6-3-7-13-27)33(41-26-39-21-19-37-2)31(23-28-14-8-4-9-15-28)35-24-29-16-10-5-11-17-29/h3-17,30-33,35H,18-26,34H2,1-2H3/t30-,31-,32+,33+/m1/s1 |
| InChIKey | LCJXZKRQRCKGLO-FYZVQMPESA-N |
| XLogP | 3.97 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|