C10H16N6O3PS2+ — CID 57270624
oxo-bis[3-sulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium (PubChem CID 57270624) has the molecular formula C10H16N6O3PS2+ and a molecular weight of 363.39 g/mol. Its IUPAC name is oxo-bis[3-sulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium.
| Compound Name | oxo-bis[3-sulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium |
|---|---|
| PubChem CID | 57270624 |
| Molecular Formula | C10H16N6O3PS2+ |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | oxo-bis[3-sulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]phosphanium |
| SMILES | O=[P+](OCCC(S)c1ncn[nH]1)OCCC(S)c1ncn[nH]1 |
| InChI | InChI=1S/C10H15N6O3PS2/c17-20(18-3-1-7(21)9-11-5-13-15-9)19-4-2-8(22)10-12-6-14-16-10/h5-8H,1-4H2,(H3-,11,12,13,14,15,16,21,22)/p+1 |
| InChIKey | SYLIANYZNKVIIG-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|