C16H28O5 — CID 57271045
4,7,8-triethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 57271045) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4,7,8-triethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | 4,7,8-triethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 57271045 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 4,7,8-triethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCOC1C=CC(OCC)C(OCC)CC(=O)OC(C)C1 |
| InChI | InChI=1S/C16H28O5/c1-5-18-13-8-9-14(19-6-2)15(20-7-3)11-16(17)21-12(4)10-13/h8-9,12-15H,5-7,10-11H2,1-4H3 |
| InChIKey | DLNWPPADKCTXBN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|