C19H18Br2N6O7S2 — CID 57271323
1,2-bis[(2-bromophenyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxyguanidine (PubChem CID 57271323) has the molecular formula C19H18Br2N6O7S2 and a molecular weight of 666.33 g/mol. Its IUPAC name is 1,2-bis[(2-bromophenyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxyguanidine.
| Compound Name | 1,2-bis[(2-bromophenyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxyguanidine |
|---|---|
| PubChem CID | 57271323 |
| Molecular Formula | C19H18Br2N6O7S2 |
| Molecular Weight | 666.33 g/mol |
| Exact Mass | 663.90 |
| IUPAC Name | 1,2-bis[(2-bromophenyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-methoxyguanidine |
| SMILES | COc1nc(NC(=NS(=O)(=O)c2ccccc2Br)N(OC)S(=O)(=O)c2ccccc2Br)nc(OC)n1 |
| InChI | InChI=1S/C19H18Br2N6O7S2/c1-32-18-23-16(24-19(25-18)33-2)22-17(26-35(28,29)14-10-6-4-8-12(14)20)27(34-3)36(30,31)15-11-7-5-9-13(15)21/h4-11H,1-3H3,(H,22,23,24,25,26) |
| InChIKey | FSPBSMPIDICTSP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 162.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|