C18H26O3 — CID 57273357
(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-7-methylocta-1,6-dienyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one (PubChem CID 57273357) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-7-methylocta-1,6-dienyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one.
| Compound Name | (3aS,4S,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-7-methylocta-1,6-dienyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 57273357 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3aS,4S,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-7-methylocta-1,6-dienyl]-2-methylidene-3,3a,4,5,6,6a-hexahydropentalen-1-one |
| SMILES | C=C1C[C@H]2[C@H](C=C[C@@H](O)CCC=C(C)C)[C@H](O)C[C@@H]2C1=O |
| InChI | InChI=1S/C18H26O3/c1-11(2)5-4-6-13(19)7-8-14-15-9-12(3)18(21)16(15)10-17(14)20/h5,7-8,13-17,19-20H,3-4,6,9-10H2,1-2H3/t13-,14-,15-,16-,17+/m0/s1 |
| InChIKey | XNBVFKULNODUGM-QUSNUVHPSA-N |
| XLogP | 2.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|