About 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene
3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 57273599) has the molecular formula C13H10S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene.
Molecular Properties
| Compound Name | 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene |
| PubChem CID | 57273599 |
| Molecular Formula | C13H10S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | CSc1ccc(-c2cc3cc-3c2)cc1 |
| InChI | InChI=1S/C13H10S/c1-14-13-4-2-9(3-5-13)10-6-11-8-12(11)7-10/h2-8H,1H3 |
| InChIKey | DNXFRNIFSKBLAR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene?
The IUPAC name of 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene (CID 57273599) is 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene.
What is the SMILES notation for 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene?
The canonical SMILES for 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene is CSc1ccc(-c2cc3cc-3c2)cc1.
What is the InChIKey of 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene?
The InChIKey is DNXFRNIFSKBLAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S/c1-14-13-4-2-9(3-5-13)10-6-11-8-12(11)7-10/h2-8H,1H3.
What are the key properties of 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene?
3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene has a molecular weight of 198.29 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylsulfanylphenyl)bicyclo[3.1.0]hexa-1(6),2,4-triene is sourced from PubChem (CID 57273599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).