C26H25ClN3O6+ — CID 57273697
[1-(chloromethyl)-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-3-ium-3-yl]carbamic acid (PubChem CID 57273697) has the molecular formula C26H25ClN3O6+ and a molecular weight of 510.95 g/mol. Its IUPAC name is [1-(chloromethyl)-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-3-ium-3-yl]carbamic acid.
| Compound Name | [1-(chloromethyl)-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-3-ium-3-yl]carbamic acid |
|---|---|
| PubChem CID | 57273697 |
| Molecular Formula | C26H25ClN3O6+ |
| Molecular Weight | 510.95 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | [1-(chloromethyl)-3-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-1,2-dihydrobenzo[e]indol-3-ium-3-yl]carbamic acid |
| SMILES | COc1cc2cc(C(=O)[N+]3(NC(=O)O)CC(CCl)c4c3ccc3ccccc43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C26H24ClN3O6/c1-34-20-11-15-10-18(28-22(15)24(36-3)23(20)35-2)25(31)30(29-26(32)33)13-16(12-27)21-17-7-5-4-6-14(17)8-9-19(21)30/h4-11,16,29H,12-13H2,1-3H3,(H-,28,31,32,33)/p+1 |
| InChIKey | BXRUXPREBMMMPH-UHFFFAOYSA-O |
| XLogP | 5.01 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|