C19H28F3NO4Si — CID 57274905
tert-butyl (4S,5S)-4-benzyl-2-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate (PubChem CID 57274905) has the molecular formula C19H28F3NO4Si and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-benzyl-2-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-benzyl-2-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57274905 |
| Molecular Formula | C19H28F3NO4Si |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | tert-butyl (4S,5S)-4-benzyl-2-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C(F)(F)F)O[C@@H](O[Si](C)(C)C)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H28F3NO4Si/c1-18(2,3)26-17(24)23-14(12-13-10-8-7-9-11-13)15(27-28(4,5)6)25-16(23)19(20,21)22/h7-11,14-16H,12H2,1-6H3/t14-,15-,16?/m0/s1 |
| InChIKey | HDAYKAXILYGYLP-KSCSMHSMSA-N |
| XLogP | 4.93 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|