C16H21NO — CID 57275100
2,7,9-trimethyl-1,3,4,4a,5,10-hexahydrobenzo[h]isoquinolin-6-one (PubChem CID 57275100) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 2,7,9-trimethyl-1,3,4,4a,5,10-hexahydrobenzo[h]isoquinolin-6-one.
| Compound Name | 2,7,9-trimethyl-1,3,4,4a,5,10-hexahydrobenzo[h]isoquinolin-6-one |
|---|---|
| PubChem CID | 57275100 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2,7,9-trimethyl-1,3,4,4a,5,10-hexahydrobenzo[h]isoquinolin-6-one |
| SMILES | CC1=CC(C)=C2C(=O)CC3CCN(C)CC3=C2C1 |
| InChI | InChI=1S/C16H21NO/c1-10-6-11(2)16-13(7-10)14-9-17(3)5-4-12(14)8-15(16)18/h6,12H,4-5,7-9H2,1-3H3 |
| InChIKey | CXHUUBIMZXQSRL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |