C21H34N2O3 — CID 57275145
(1S,3aS,5S,7aR)-1-[[2-(dimethylamino)ethoxyamino]methyl]-5-(3-hydroxyphenyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol (PubChem CID 57275145) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is (1S,3aS,5S,7aR)-1-[[2-(dimethylamino)ethoxyamino]methyl]-5-(3-hydroxyphenyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol.
| Compound Name | (1S,3aS,5S,7aR)-1-[[2-(dimethylamino)ethoxyamino]methyl]-5-(3-hydroxyphenyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
|---|---|
| PubChem CID | 57275145 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (1S,3aS,5S,7aR)-1-[[2-(dimethylamino)ethoxyamino]methyl]-5-(3-hydroxyphenyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
| SMILES | CN(C)CCONC[C@H]1CC[C@]2(O)C[C@@H](c3cccc(O)c3)CC[C@]12C |
| InChI | InChI=1S/C21H34N2O3/c1-20-9-7-17(16-5-4-6-19(24)13-16)14-21(20,25)10-8-18(20)15-22-26-12-11-23(2)3/h4-6,13,17-18,22,24-25H,7-12,14-15H2,1-3H3/t17-,18+,20+,21-/m0/s1 |
| InChIKey | MYUJCJOIPMIIAO-ZSXPUABSSA-N |
| XLogP | 2.89 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|