C26H52O4Si2 — CID 57275712
2,6-dimethyl-9-[(2S,3R)-2-methyl-3-trimethylsilyloxy-6-(2-trimethylsilyloxyethylidene)oxepan-2-yl]non-2-en-5-ol (PubChem CID 57275712) has the molecular formula C26H52O4Si2 and a molecular weight of 484.87 g/mol. Its IUPAC name is 2,6-dimethyl-9-[(2S,3R)-2-methyl-3-trimethylsilyloxy-6-(2-trimethylsilyloxyethylidene)oxepan-2-yl]non-2-en-5-ol.
| Compound Name | 2,6-dimethyl-9-[(2S,3R)-2-methyl-3-trimethylsilyloxy-6-(2-trimethylsilyloxyethylidene)oxepan-2-yl]non-2-en-5-ol |
|---|---|
| PubChem CID | 57275712 |
| Molecular Formula | C26H52O4Si2 |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | 2,6-dimethyl-9-[(2S,3R)-2-methyl-3-trimethylsilyloxy-6-(2-trimethylsilyloxyethylidene)oxepan-2-yl]non-2-en-5-ol |
| SMILES | CC(C)=CCC(O)C(C)CCC[C@]1(C)OCC(=CCO[Si](C)(C)C)CC[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C26H52O4Si2/c1-21(2)13-15-24(27)22(3)12-11-18-26(4)25(30-32(8,9)10)16-14-23(20-28-26)17-19-29-31(5,6)7/h13,17,22,24-25,27H,11-12,14-16,18-20H2,1-10H3/t22?,24?,25-,26+/m1/s1 |
| InChIKey | BVJRSIRSLRSOPR-UKTLEQMESA-N |
| XLogP | 7.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|