About N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide
N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide (PubChem CID 57275756) has the molecular formula C12H24FNO
and a molecular weight of 217.33 g/mol. Its IUPAC name is N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide |
| PubChem CID | 57275756 |
| Molecular Formula | C12H24FNO |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide |
| SMILES | CCCC(C)C(NC(C)=O)C(C)(C)CF |
| InChI | InChI=1S/C12H24FNO/c1-6-7-9(2)11(14-10(3)15)12(4,5)8-13/h9,11H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | DLIKRFAUJOSJEW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide?
The IUPAC name of N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide (CID 57275756) is N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide.
What is the SMILES notation for N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide?
The canonical SMILES for N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide is CCCC(C)C(NC(C)=O)C(C)(C)CF.
What is the InChIKey of N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide?
The InChIKey is DLIKRFAUJOSJEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24FNO/c1-6-7-9(2)11(14-10(3)15)12(4,5)8-13/h9,11H,6-8H2,1-5H3,(H,14,15).
What are the key properties of N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide?
N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide has a molecular weight of 217.33 g/mol, XLogP of 2.92, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-fluoro-2,2,4-trimethylheptan-3-yl)acetamide is sourced from PubChem (CID 57275756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).