C25H33NO3 — CID 57275797
ethyl 5-[(1S,2S)-2-(1-acetyl-4,4-dimethyl-2,3-dihydroquinolin-7-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate (PubChem CID 57275797) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is ethyl 5-[(1S,2S)-2-(1-acetyl-4,4-dimethyl-2,3-dihydroquinolin-7-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[(1S,2S)-2-(1-acetyl-4,4-dimethyl-2,3-dihydroquinolin-7-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 57275797 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | ethyl 5-[(1S,2S)-2-(1-acetyl-4,4-dimethyl-2,3-dihydroquinolin-7-yl)-2-methylcyclopropyl]-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C)C=C[C@@H]1C[C@]1(C)c1ccc2c(c1)N(C(C)=O)CCC2(C)C |
| InChI | InChI=1S/C25H33NO3/c1-7-29-23(28)14-17(2)8-9-20-16-25(20,6)19-10-11-21-22(15-19)26(18(3)27)13-12-24(21,4)5/h8-11,14-15,20H,7,12-13,16H2,1-6H3/t20-,25-/m1/s1 |
| InChIKey | RNWMZKVKWPXCCI-CJFMBICVSA-N |
| XLogP | 5.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|