C28H34N4O3 — CID 57276228
butyl N-[amino-[4-[3-[3-methyl-4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate (PubChem CID 57276228) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is butyl N-[amino-[4-[3-[3-methyl-4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate.
| Compound Name | butyl N-[amino-[4-[3-[3-methyl-4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 57276228 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | butyl N-[amino-[4-[3-[3-methyl-4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate |
| SMILES | CCCCOC(=O)N=C(N)c1ccc(NCC#Cc2ccc(C(=O)N3CCCC3C)c(C)c2)cc1 |
| InChI | InChI=1S/C28H34N4O3/c1-4-5-18-35-28(34)31-26(29)23-11-13-24(14-12-23)30-16-6-9-22-10-15-25(20(2)19-22)27(33)32-17-7-8-21(32)3/h10-15,19,21,30H,4-5,7-8,16-18H2,1-3H3,(H2,29,31,34) |
| InChIKey | BTMTWLPYCVUTPR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|