About 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol
4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol (PubChem CID 57276240) has the molecular formula C19H13Cl2FO3
and a molecular weight of 379.21 g/mol. Its IUPAC name is 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol.
Molecular Properties
| Compound Name | 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol |
| PubChem CID | 57276240 |
| Molecular Formula | C19H13Cl2FO3 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol |
| SMILES | Oc1ccc(OCc2cc(Cl)c(Oc3ccc(F)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H13Cl2FO3/c20-17-9-12(11-24-15-7-3-14(23)4-8-15)10-18(21)19(17)25-16-5-1-13(22)2-6-16/h1-10,23H,11H2 |
| InChIKey | FIYFRKQRCLYQEA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol?
The IUPAC name of 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol (CID 57276240) is 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol.
What is the SMILES notation for 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol?
The canonical SMILES for 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol is Oc1ccc(OCc2cc(Cl)c(Oc3ccc(F)cc3)c(Cl)c2)cc1.
What is the InChIKey of 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol?
The InChIKey is FIYFRKQRCLYQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2FO3/c20-17-9-12(11-24-15-7-3-14(23)4-8-15)10-18(21)19(17)25-16-5-1-13(22)2-6-16/h1-10,23H,11H2.
What are the key properties of 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol?
4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol has a molecular weight of 379.21 g/mol, XLogP of 6.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-dichloro-4-(4-fluorophenoxy)phenyl]methoxy]phenol is sourced from PubChem (CID 57276240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).