C19H31F — CID 57277058
(8S,9R,10R,13S,14S)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 57277058) has the molecular formula C19H31F and a molecular weight of 278.45 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10R,13S,14S)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 57277058 |
| Molecular Formula | C19H31F |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | (8S,9R,10R,13S,14S)-4-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3C(F)CCC[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C19H31F/c1-18-10-3-5-14(18)13-7-8-16-17(20)6-4-11-19(16,2)15(13)9-12-18/h13-17H,3-12H2,1-2H3/t13-,14-,15+,16?,17?,18-,19+/m0/s1 |
| InChIKey | DGZZKACRPCAKNK-SCXPDFSWSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |