About 3,3-dichlorothiolane
3,3-dichlorothiolane (PubChem CID 57277185) has the molecular formula C4H6Cl2S
and a molecular weight of 157.06 g/mol. Its IUPAC name is 3,3-dichlorothiolane.
Molecular Properties
| Compound Name | 3,3-dichlorothiolane |
| PubChem CID | 57277185 |
| Molecular Formula | C4H6Cl2S |
| Molecular Weight | 157.06 g/mol |
| Exact Mass | 155.96 |
| IUPAC Name | 3,3-dichlorothiolane |
| SMILES | ClC1(Cl)CCSC1 |
| InChI | InChI=1S/C4H6Cl2S/c5-4(6)1-2-7-3-4/h1-3H2 |
| InChIKey | COZJQEYZTAUTQQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.06 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dichlorothiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dichlorothiolane?
The IUPAC name of 3,3-dichlorothiolane (CID 57277185) is 3,3-dichlorothiolane.
What is the SMILES notation for 3,3-dichlorothiolane?
The canonical SMILES for 3,3-dichlorothiolane is ClC1(Cl)CCSC1.
What is the InChIKey of 3,3-dichlorothiolane?
The InChIKey is COZJQEYZTAUTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl2S/c5-4(6)1-2-7-3-4/h1-3H2.
What are the key properties of 3,3-dichlorothiolane?
3,3-dichlorothiolane has a molecular weight of 157.06 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dichlorothiolane is sourced from PubChem (CID 57277185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).