About 1-nonylprismane
1-nonylprismane (PubChem CID 57277372) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is 1-nonylprismane.
Molecular Properties
| Compound Name | 1-nonylprismane |
| PubChem CID | 57277372 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 1-nonylprismane |
| SMILES | CCCCCCCCCC12C3C4C3C1C42 |
| InChI | InChI=1S/C15H24/c1-2-3-4-5-6-7-8-9-15-12-10-11(12)14(15)13(10)15/h10-14H,2-9H2,1H3 |
| InChIKey | VIIGRMKGARNUGJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonylprismane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonylprismane?
The IUPAC name of 1-nonylprismane (CID 57277372) is 1-nonylprismane.
What is the SMILES notation for 1-nonylprismane?
The canonical SMILES for 1-nonylprismane is CCCCCCCCCC12C3C4C3C1C42.
What is the InChIKey of 1-nonylprismane?
The InChIKey is VIIGRMKGARNUGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24/c1-2-3-4-5-6-7-8-9-15-12-10-11(12)14(15)13(10)15/h10-14H,2-9H2,1H3.
What are the key properties of 1-nonylprismane?
1-nonylprismane has a molecular weight of 204.36 g/mol, XLogP of 4.25, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonylprismane is sourced from PubChem (CID 57277372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).