C16H21Cl2NO — CID 57278159
(4bS,8aR)-4b-(2-aminoethyl)-1,3-dichloro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol (PubChem CID 57278159) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is (4bS,8aR)-4b-(2-aminoethyl)-1,3-dichloro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol.
| Compound Name | (4bS,8aR)-4b-(2-aminoethyl)-1,3-dichloro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol |
|---|---|
| PubChem CID | 57278159 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (4bS,8aR)-4b-(2-aminoethyl)-1,3-dichloro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol |
| SMILES | NCC[C@]12CCCC[C@@]1(O)CCc1c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C16H21Cl2NO/c17-11-9-13-12(14(18)10-11)3-6-16(20)5-2-1-4-15(13,16)7-8-19/h9-10,20H,1-8,19H2/t15-,16+/m0/s1 |
| InChIKey | NPHQVUVIFPHVDL-JKSUJKDBSA-N |
| XLogP | 3.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |