C14H20N2O — CID 57278810
5-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)hexanal (PubChem CID 57278810) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)hexanal.
| Compound Name | 5-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)hexanal |
|---|---|
| PubChem CID | 57278810 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 5-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)hexanal |
| SMILES | CC(CCCC=O)N1CCc2ncccc2C1 |
| InChI | InChI=1S/C14H20N2O/c1-12(5-2-3-10-17)16-9-7-14-13(11-16)6-4-8-15-14/h4,6,8,10,12H,2-3,5,7,9,11H2,1H3 |
| InChIKey | UQBLBFYSRXTYGM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|