C18H26N2 — CID 57278890
9,10,15,16-tetramethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),6-triene (PubChem CID 57278890) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 9,10,15,16-tetramethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),6-triene.
| Compound Name | 9,10,15,16-tetramethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),6-triene |
|---|---|
| PubChem CID | 57278890 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 9,10,15,16-tetramethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),6-triene |
| SMILES | CC1C2CC3=C4C=CCN(C)C(C)(C3)C(C)C1N=C2C4 |
| InChI | InChI=1S/C18H26N2/c1-11-15-8-14-10-18(3)12(2)17(11)19-16(15)9-13(14)6-5-7-20(18)4/h5-6,11-12,15,17H,7-10H2,1-4H3 |
| InChIKey | QRVRRFRIHYYRPT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |