C16H24N6O5PS4+ — CID 57279049
bis[3-ethoxycarbothioylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium (PubChem CID 57279049) has the molecular formula C16H24N6O5PS4+ and a molecular weight of 539.65 g/mol. Its IUPAC name is bis[3-ethoxycarbothioylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium.
| Compound Name | bis[3-ethoxycarbothioylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 57279049 |
| Molecular Formula | C16H24N6O5PS4+ |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | bis[3-ethoxycarbothioylsulfanyl-3-(1H-1,2,4-triazol-5-yl)propoxy]-oxophosphanium |
| SMILES | CCOC(=S)SC(CCO[P+](=O)OCCC(SC(=S)OCC)c1ncn[nH]1)c1ncn[nH]1 |
| InChI | InChI=1S/C16H24N6O5PS4/c1-3-24-15(29)31-11(13-17-9-19-21-13)5-7-26-28(23)27-8-6-12(14-18-10-20-22-14)32-16(30)25-4-2/h9-12H,3-8H2,1-2H3,(H,17,19,21)(H,18,20,22)/q+1 |
| InChIKey | KFOYXZNLUGLLRX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|