C20H16Cl4F3NO3 — CID 57279464
N-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine (PubChem CID 57279464) has the molecular formula C20H16Cl4F3NO3 and a molecular weight of 517.16 g/mol. Its IUPAC name is N-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine.
| Compound Name | N-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine |
|---|---|
| PubChem CID | 57279464 |
| Molecular Formula | C20H16Cl4F3NO3 |
| Molecular Weight | 517.16 g/mol |
| Exact Mass | 514.98 |
| IUPAC Name | N-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethoxy]-1-[4-(trifluoromethyl)phenyl]ethenamine |
| SMILES | C=C(NOCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16Cl4F3NO3/c1-12(13-2-4-14(5-3-13)20(25,26)27)28-31-9-8-30-19-16(21)10-15(11-17(19)22)29-7-6-18(23)24/h2-6,10-11,28H,1,7-9H2 |
| InChIKey | XGXUQXUDRDQDPN-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.16 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|