About 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine
1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine (PubChem CID 57279465) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine.
Molecular Properties
| Compound Name | 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine |
| PubChem CID | 57279465 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine |
| SMILES | C=CCN1CCN(C2=NCC(C)O2)C(N)C1 |
| InChI | InChI=1S/C11H20N4O/c1-3-4-14-5-6-15(10(12)8-14)11-13-7-9(2)16-11/h3,9-10H,1,4-8,12H2,2H3 |
| InChIKey | JOVRLCLRGFAXEM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine?
The IUPAC name of 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine (CID 57279465) is 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine.
What is the SMILES notation for 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine?
The canonical SMILES for 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine is C=CCN1CCN(C2=NCC(C)O2)C(N)C1.
What is the InChIKey of 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine?
The InChIKey is JOVRLCLRGFAXEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-3-4-14-5-6-15(10(12)8-14)11-13-7-9(2)16-11/h3,9-10H,1,4-8,12H2,2H3.
What are the key properties of 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine?
1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine has a molecular weight of 224.31 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)-4-prop-2-enylpiperazin-2-amine is sourced from PubChem (CID 57279465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).