C11H16N2O3 — CID 57279560
1,7-bis(dimethylamino)hepta-1,6-diene-3,4,5-trione (PubChem CID 57279560) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1,7-bis(dimethylamino)hepta-1,6-diene-3,4,5-trione.
| Compound Name | 1,7-bis(dimethylamino)hepta-1,6-diene-3,4,5-trione |
|---|---|
| PubChem CID | 57279560 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1,7-bis(dimethylamino)hepta-1,6-diene-3,4,5-trione |
| SMILES | CN(C)C=CC(=O)C(=O)C(=O)C=CN(C)C |
| InChI | InChI=1S/C11H16N2O3/c1-12(2)7-5-9(14)11(16)10(15)6-8-13(3)4/h5-8H,1-4H3 |
| InChIKey | DYYLHOVSTFMSCL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|