C12H8F14O3 — CID 57280272
1,1,1,2,2,3,3-heptafluoro-3-[1-[1-(1,1,2,2,3,3,3-heptafluoropropoxy)prop-2-enoxy]prop-2-enoxy]propane (PubChem CID 57280272) has the molecular formula C12H8F14O3 and a molecular weight of 466.17 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-[1-[1-(1,1,2,2,3,3,3-heptafluoropropoxy)prop-2-enoxy]prop-2-enoxy]propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-[1-[1-(1,1,2,2,3,3,3-heptafluoropropoxy)prop-2-enoxy]prop-2-enoxy]propane |
|---|---|
| PubChem CID | 57280272 |
| Molecular Formula | C12H8F14O3 |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-[1-[1-(1,1,2,2,3,3,3-heptafluoropropoxy)prop-2-enoxy]prop-2-enoxy]propane |
| SMILES | C=CC(OC(C=C)OC(F)(F)C(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F14O3/c1-3-5(28-11(23,24)7(13,14)9(17,18)19)27-6(4-2)29-12(25,26)8(15,16)10(20,21)22/h3-6H,1-2H2 |
| InChIKey | XJKDUXZHMAIEQU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|