C22H26F3NO2S — CID 57280276
(2S)-1-[(3S,5S)-3-ethyl-8-methoxy-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepin-3-yl]-4,4,4-trifluorobutan-2-ol (PubChem CID 57280276) has the molecular formula C22H26F3NO2S and a molecular weight of 425.52 g/mol. Its IUPAC name is (2S)-1-[(3S,5S)-3-ethyl-8-methoxy-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepin-3-yl]-4,4,4-trifluorobutan-2-ol.
| Compound Name | (2S)-1-[(3S,5S)-3-ethyl-8-methoxy-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepin-3-yl]-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 57280276 |
| Molecular Formula | C22H26F3NO2S |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (2S)-1-[(3S,5S)-3-ethyl-8-methoxy-5-phenyl-4,5-dihydro-2H-1,4-benzothiazepin-3-yl]-4,4,4-trifluorobutan-2-ol |
| SMILES | CC[C@]1(C[C@H](O)CC(F)(F)F)CSc2cc(OC)ccc2[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C22H26F3NO2S/c1-3-21(12-16(27)13-22(23,24)25)14-29-19-11-17(28-2)9-10-18(19)20(26-21)15-7-5-4-6-8-15/h4-11,16,20,26-27H,3,12-14H2,1-2H3/t16-,20-,21-/m0/s1 |
| InChIKey | HMPCJOZKQYMDDZ-NDXORKPFSA-N |
| XLogP | 5.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |