About N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine
N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine (PubChem CID 57280513) has the molecular formula C21H34N2O2
and a molecular weight of 346.52 g/mol. Its IUPAC name is N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine |
| PubChem CID | 57280513 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine |
| SMILES | C=CCC(C=C(NOCC)c1ccccc1)COCCCNC(C)C |
| InChI | InChI=1S/C21H34N2O2/c1-5-11-19(17-24-15-10-14-22-18(3)4)16-21(23-25-6-2)20-12-8-7-9-13-20/h5,7-9,12-13,16,18-19,22-23H,1,6,10-11,14-15,17H2,2-4H3 |
| InChIKey | PGJHCYKWWWPARC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine?
The IUPAC name of N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine (CID 57280513) is N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine.
What is the SMILES notation for N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine?
The canonical SMILES for N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine is C=CCC(C=C(NOCC)c1ccccc1)COCCCNC(C)C.
What is the InChIKey of N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine?
The InChIKey is PGJHCYKWWWPARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O2/c1-5-11-19(17-24-15-10-14-22-18(3)4)16-21(23-25-6-2)20-12-8-7-9-13-20/h5,7-9,12-13,16,18-19,22-23H,1,6,10-11,14-15,17H2,2-4H3.
What are the key properties of N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine?
N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine has a molecular weight of 346.52 g/mol, XLogP of 4.17, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-1-phenyl-3-[3-(propan-2-ylamino)propoxymethyl]hexa-1,5-dien-1-amine is sourced from PubChem (CID 57280513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).