C26H46O5 — CID 57280601
ethyl 7-[(1R,2R)-2-hydroxy-5-[2-[2-(2-methylhexan-2-yl)-1,3-dioxolan-2-yl]ethylidene]cyclopentyl]heptanoate (PubChem CID 57280601) has the molecular formula C26H46O5 and a molecular weight of 438.65 g/mol. Its IUPAC name is ethyl 7-[(1R,2R)-2-hydroxy-5-[2-[2-(2-methylhexan-2-yl)-1,3-dioxolan-2-yl]ethylidene]cyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1R,2R)-2-hydroxy-5-[2-[2-(2-methylhexan-2-yl)-1,3-dioxolan-2-yl]ethylidene]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 57280601 |
| Molecular Formula | C26H46O5 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | ethyl 7-[(1R,2R)-2-hydroxy-5-[2-[2-(2-methylhexan-2-yl)-1,3-dioxolan-2-yl]ethylidene]cyclopentyl]heptanoate |
| SMILES | CCCCC(C)(C)C1(CC=C2CC[C@@H](O)[C@@H]2CCCCCCC(=O)OCC)OCCO1 |
| InChI | InChI=1S/C26H46O5/c1-5-7-17-25(3,4)26(30-19-20-31-26)18-16-21-14-15-23(27)22(21)12-10-8-9-11-13-24(28)29-6-2/h16,22-23,27H,5-15,17-20H2,1-4H3/t22-,23-/m1/s1 |
| InChIKey | FQDFXTLBUODSOM-DHIUTWEWSA-N |
| XLogP | 5.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|