C15H23ClN2 — CID 57280667
4-chloro-N,N-dipropyl-6,7,8,8a-tetrahydroquinolin-7-amine (PubChem CID 57280667) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 4-chloro-N,N-dipropyl-6,7,8,8a-tetrahydroquinolin-7-amine.
| Compound Name | 4-chloro-N,N-dipropyl-6,7,8,8a-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 57280667 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-chloro-N,N-dipropyl-6,7,8,8a-tetrahydroquinolin-7-amine |
| SMILES | CCCN(CCC)C1CC=C2C(Cl)=CC=NC2C1 |
| InChI | InChI=1S/C15H23ClN2/c1-3-9-18(10-4-2)12-5-6-13-14(16)7-8-17-15(13)11-12/h6-8,12,15H,3-5,9-11H2,1-2H3 |
| InChIKey | QWUZEIOMCMKVKQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |