C6H10NO3S- — CID 57280782
1-(ethylamino)-1-oxobut-3-ene-2-sulfinate (PubChem CID 57280782) has the molecular formula C6H10NO3S- and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-(ethylamino)-1-oxobut-3-ene-2-sulfinate.
| Compound Name | 1-(ethylamino)-1-oxobut-3-ene-2-sulfinate |
|---|---|
| PubChem CID | 57280782 |
| Molecular Formula | C6H10NO3S- |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 1-(ethylamino)-1-oxobut-3-ene-2-sulfinate |
| SMILES | C=CC(C(=O)NCC)S(=O)[O-] |
| InChI | InChI=1S/C6H11NO3S/c1-3-5(11(9)10)6(8)7-4-2/h3,5H,1,4H2,2H3,(H,7,8)(H,9,10)/p-1 |
| InChIKey | ANXFAFURGWQGLY-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|