C39H40N2O2 — CID 57281079
4-[4-[[(2S,4R)-5-oxo-1,4-bis(3-phenylpropyl)-4-prop-2-enylpyrrolidin-2-yl]methoxy]phenyl]benzonitrile (PubChem CID 57281079) has the molecular formula C39H40N2O2 and a molecular weight of 568.76 g/mol. Its IUPAC name is 4-[4-[[(2S,4R)-5-oxo-1,4-bis(3-phenylpropyl)-4-prop-2-enylpyrrolidin-2-yl]methoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[[(2S,4R)-5-oxo-1,4-bis(3-phenylpropyl)-4-prop-2-enylpyrrolidin-2-yl]methoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 57281079 |
| Molecular Formula | C39H40N2O2 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 4-[4-[[(2S,4R)-5-oxo-1,4-bis(3-phenylpropyl)-4-prop-2-enylpyrrolidin-2-yl]methoxy]phenyl]benzonitrile |
| SMILES | C=CC[C@]1(CCCc2ccccc2)C[C@@H](COc2ccc(-c3ccc(C#N)cc3)cc2)N(CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C39H40N2O2/c1-2-25-39(26-9-15-31-11-5-3-6-12-31)28-36(41(38(39)42)27-10-16-32-13-7-4-8-14-32)30-43-37-23-21-35(22-24-37)34-19-17-33(29-40)18-20-34/h2-8,11-14,17-24,36H,1,9-10,15-16,25-28,30H2/t36-,39-/m0/s1 |
| InChIKey | NKAHVYFFQQQDSZ-VQIIKMDRSA-N |
| XLogP | 8.42 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|