C31H52O3SSi — CID 57281233
3-[[(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpropane-1,2-diol (PubChem CID 57281233) has the molecular formula C31H52O3SSi and a molecular weight of 532.91 g/mol. Its IUPAC name is 3-[[(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpropane-1,2-diol.
| Compound Name | 3-[[(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 57281233 |
| Molecular Formula | C31H52O3SSi |
| Molecular Weight | 532.91 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | 3-[[(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpropane-1,2-diol |
| SMILES | CCC1=CC[C@H]2C3=CC=C4CC(SCC(C)(O)CO)CC(O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H52O3SSi/c1-10-21-12-14-25-24-13-11-22-17-23(35-20-29(5,33)19-32)18-27(34-36(8,9)28(2,3)4)31(22,7)26(24)15-16-30(21,25)6/h11-13,23,25-27,32-33H,10,14-20H2,1-9H3/t23?,25-,26-,27?,29?,30+,31-/m0/s1 |
| InChIKey | WMQLMUJNDAIYQV-UOQITZIXSA-N |
| XLogP | 7.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.91 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|