C13H20O4 — CID 57281489
3-butanoyl-5,5,6,6-tetramethyloxane-2,4-dione (PubChem CID 57281489) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-butanoyl-5,5,6,6-tetramethyloxane-2,4-dione.
| Compound Name | 3-butanoyl-5,5,6,6-tetramethyloxane-2,4-dione |
|---|---|
| PubChem CID | 57281489 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-butanoyl-5,5,6,6-tetramethyloxane-2,4-dione |
| SMILES | CCCC(=O)C1C(=O)OC(C)(C)C(C)(C)C1=O |
| InChI | InChI=1S/C13H20O4/c1-6-7-8(14)9-10(15)12(2,3)13(4,5)17-11(9)16/h9H,6-7H2,1-5H3 |
| InChIKey | FJQGIRAPIMNHLV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|