C15H19N — CID 57281653
15-azatetracyclo[7.5.2.01,10.02,7]hexadeca-5,7,9-triene (PubChem CID 57281653) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 15-azatetracyclo[7.5.2.01,10.02,7]hexadeca-5,7,9-triene.
| Compound Name | 15-azatetracyclo[7.5.2.01,10.02,7]hexadeca-5,7,9-triene |
|---|---|
| PubChem CID | 57281653 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 15-azatetracyclo[7.5.2.01,10.02,7]hexadeca-5,7,9-triene |
| SMILES | C1=CC2=CC3=C4CCCCC4(NC3)C2CC1 |
| InChI | InChI=1S/C15H19N/c1-2-6-13-11(5-1)9-12-10-16-15(13)8-4-3-7-14(12)15/h1,5,9,13,16H,2-4,6-8,10H2 |
| InChIKey | QQYOPNDZMVYLAB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |