About 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride
4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride (PubChem CID 57281902) has the molecular formula C13H8Cl2F5NO2
and a molecular weight of 376.11 g/mol. Its IUPAC name is 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride.
Molecular Properties
| Compound Name | 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride |
| PubChem CID | 57281902 |
| Molecular Formula | C13H8Cl2F5NO2 |
| Molecular Weight | 376.11 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride |
| SMILES | O=C(Cl)c1c(C(F)F)nc(C(F)(F)F)c(C(=O)Cl)c1C1CCC1 |
| InChI | InChI=1S/C13H8Cl2F5NO2/c14-10(22)6-5(4-2-1-3-4)7(11(15)23)9(13(18,19)20)21-8(6)12(16)17/h4,12H,1-3H2 |
| InChIKey | AUOFFOXFNXRGAL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.11 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride?
The IUPAC name of 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride (CID 57281902) is 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride.
What is the SMILES notation for 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride?
The canonical SMILES for 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride is O=C(Cl)c1c(C(F)F)nc(C(F)(F)F)c(C(=O)Cl)c1C1CCC1.
What is the InChIKey of 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride?
The InChIKey is AUOFFOXFNXRGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2F5NO2/c14-10(22)6-5(4-2-1-3-4)7(11(15)23)9(13(18,19)20)21-8(6)12(16)17/h4,12H,1-3H2.
What are the key properties of 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride?
4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride has a molecular weight of 376.11 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclobutyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbonyl chloride is sourced from PubChem (CID 57281902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).