C11H17NO3 — CID 57282025
spiro[1,3,4,4a,5,7,8,8a-octahydroquinoline-6,2'-1,3-dioxolane]-2-one (PubChem CID 57282025) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is spiro[1,3,4,4a,5,7,8,8a-octahydroquinoline-6,2'-1,3-dioxolane]-2-one.
| Compound Name | spiro[1,3,4,4a,5,7,8,8a-octahydroquinoline-6,2'-1,3-dioxolane]-2-one |
|---|---|
| PubChem CID | 57282025 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | spiro[1,3,4,4a,5,7,8,8a-octahydroquinoline-6,2'-1,3-dioxolane]-2-one |
| SMILES | O=C1CCC2CC3(CCC2N1)OCCO3 |
| InChI | InChI=1S/C11H17NO3/c13-10-2-1-8-7-11(14-5-6-15-11)4-3-9(8)12-10/h8-9H,1-7H2,(H,12,13) |
| InChIKey | YUIMPQDGCGUBHC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |