C15H32N2O2 — CID 57282984
1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)hexane-1,6-diol (PubChem CID 57282984) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)hexane-1,6-diol.
| Compound Name | 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)hexane-1,6-diol |
|---|---|
| PubChem CID | 57282984 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)hexane-1,6-diol |
| SMILES | CC1(C)CC(N)CC(C)(C)N1C(O)CCCCCO |
| InChI | InChI=1S/C15H32N2O2/c1-14(2)10-12(16)11-15(3,4)17(14)13(19)8-6-5-7-9-18/h12-13,18-19H,5-11,16H2,1-4H3 |
| InChIKey | YELFADSUYLQYTL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|