About 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione
2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione (PubChem CID 57283145) has the molecular formula C26H24N2O5
and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione |
| PubChem CID | 57283145 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione |
| SMILES | CC(C)c1cc(-c2ccc(N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)cc2)cc(C(C)C)c1O |
| InChI | InChI=1S/C26H24N2O5/c1-14(2)21-11-17(12-22(15(3)4)24(21)29)16-5-7-18(8-6-16)27-25(30)20-10-9-19(28(32)33)13-23(20)26(27)31/h5-15,29H,1-4H3 |
| InChIKey | SWWVVPWNUOMEFP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione?
The IUPAC name of 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione (CID 57283145) is 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione.
What is the SMILES notation for 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione?
The canonical SMILES for 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione is CC(C)c1cc(-c2ccc(N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)cc2)cc(C(C)C)c1O.
What is the InChIKey of 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione?
The InChIKey is SWWVVPWNUOMEFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O5/c1-14(2)21-11-17(12-22(15(3)4)24(21)29)16-5-7-18(8-6-16)27-25(30)20-10-9-19(28(32)33)13-23(20)26(27)31/h5-15,29H,1-4H3.
What are the key properties of 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione?
2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione has a molecular weight of 444.49 g/mol, XLogP of 6.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]phenyl]-5-nitroisoindole-1,3-dione is sourced from PubChem (CID 57283145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).