About (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine
(4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine (PubChem CID 57283350) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine |
| PubChem CID | 57283350 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine |
| SMILES | CC(C)C1N[C@H](CSCc2ccccc2)CO1 |
| InChI | InChI=1S/C14H21NOS/c1-11(2)14-15-13(8-16-14)10-17-9-12-6-4-3-5-7-12/h3-7,11,13-15H,8-10H2,1-2H3/t13-,14?/m0/s1 |
| InChIKey | STLMBRPPNJXBTP-LSLKUGRBSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine?
The IUPAC name of (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine (CID 57283350) is (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine.
What is the SMILES notation for (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine?
The canonical SMILES for (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine is CC(C)C1N[C@H](CSCc2ccccc2)CO1.
What is the InChIKey of (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine?
The InChIKey is STLMBRPPNJXBTP-LSLKUGRBSA-N. The full InChI is InChI=1S/C14H21NOS/c1-11(2)14-15-13(8-16-14)10-17-9-12-6-4-3-5-7-12/h3-7,11,13-15H,8-10H2,1-2H3/t13-,14?/m0/s1.
What are the key properties of (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine?
(4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine has a molecular weight of 251.39 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(benzylsulfanylmethyl)-2-propan-2-yl-1,3-oxazolidine is sourced from PubChem (CID 57283350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).