About 5-hydroxy-3-oxopentanal
5-hydroxy-3-oxopentanal (PubChem CID 57283625) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is 5-hydroxy-3-oxopentanal.
Molecular Properties
| Compound Name | 5-hydroxy-3-oxopentanal |
| PubChem CID | 57283625 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | 5-hydroxy-3-oxopentanal |
| SMILES | O=CCC(=O)CCO |
| InChI | InChI=1S/C5H8O3/c6-3-1-5(8)2-4-7/h3,7H,1-2,4H2 |
| InChIKey | ZSJOVUGBPPFONP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-3-oxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3-oxopentanal?
The IUPAC name of 5-hydroxy-3-oxopentanal (CID 57283625) is 5-hydroxy-3-oxopentanal.
What is the SMILES notation for 5-hydroxy-3-oxopentanal?
The canonical SMILES for 5-hydroxy-3-oxopentanal is O=CCC(=O)CCO.
What is the InChIKey of 5-hydroxy-3-oxopentanal?
The InChIKey is ZSJOVUGBPPFONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c6-3-1-5(8)2-4-7/h3,7H,1-2,4H2.
What are the key properties of 5-hydroxy-3-oxopentanal?
5-hydroxy-3-oxopentanal has a molecular weight of 116.12 g/mol, XLogP of -0.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3-oxopentanal is sourced from PubChem (CID 57283625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).