C8H15NO — CID 57283911
1-(2,3,4,5-tetrahydropyridin-3-yl)propan-1-ol (PubChem CID 57283911) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 1-(2,3,4,5-tetrahydropyridin-3-yl)propan-1-ol.
| Compound Name | 1-(2,3,4,5-tetrahydropyridin-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 57283911 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1-(2,3,4,5-tetrahydropyridin-3-yl)propan-1-ol |
| SMILES | CCC(O)C1CCC=NC1 |
| InChI | InChI=1S/C8H15NO/c1-2-8(10)7-4-3-5-9-6-7/h5,7-8,10H,2-4,6H2,1H3 |
| InChIKey | GNYKJRHOPGPBIM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |