C24H26O15 — CID 57283987
1-[2-oxo-2-[2-(2,3,5-tricarboxy-1-bicyclo[2.2.1]heptanyl)acetyl]oxyethyl]bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid (PubChem CID 57283987) has the molecular formula C24H26O15 and a molecular weight of 554.46 g/mol. Its IUPAC name is 1-[2-oxo-2-[2-(2,3,5-tricarboxy-1-bicyclo[2.2.1]heptanyl)acetyl]oxyethyl]bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid.
| Compound Name | 1-[2-oxo-2-[2-(2,3,5-tricarboxy-1-bicyclo[2.2.1]heptanyl)acetyl]oxyethyl]bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 57283987 |
| Molecular Formula | C24H26O15 |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 1-[2-oxo-2-[2-(2,3,5-tricarboxy-1-bicyclo[2.2.1]heptanyl)acetyl]oxyethyl]bicyclo[2.2.1]heptane-2,3,5-tricarboxylic acid |
| SMILES | O=C(CC12CC(C(=O)O)C(C1)C(C(=O)O)C2C(=O)O)OC(=O)CC12CC(C(=O)O)C(C1)C(C(=O)O)C2C(=O)O |
| InChI | InChI=1S/C24H26O15/c25-11(5-23-1-7(9(3-23)17(27)28)13(19(31)32)15(23)21(35)36)39-12(26)6-24-2-8(10(4-24)18(29)30)14(20(33)34)16(24)22(37)38/h7-10,13-16H,1-6H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | HUIXZSRJPWOCEB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 267.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|