C20H21N5O3S2 — CID 57284068
3-[(6-aminonaphthalen-2-yl)-sulfinoamino]-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidine (PubChem CID 57284068) has the molecular formula C20H21N5O3S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-[(6-aminonaphthalen-2-yl)-sulfinoamino]-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidine.
| Compound Name | 3-[(6-aminonaphthalen-2-yl)-sulfinoamino]-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidine |
|---|---|
| PubChem CID | 57284068 |
| Molecular Formula | C20H21N5O3S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 3-[(6-aminonaphthalen-2-yl)-sulfinoamino]-1-[(5-carbamimidoylthiophen-3-yl)methyl]-2-oxopyrrolidine |
| SMILES | [H]/N=C(\N)c1cc(CN2CCC(N(c3ccc4cc(N)ccc4c3)S(=O)O)C2=O)cs1 |
| InChI | InChI=1S/C20H21N5O3S2/c21-15-3-1-14-9-16(4-2-13(14)8-15)25(30(27)28)17-5-6-24(20(17)26)10-12-7-18(19(22)23)29-11-12/h1-4,7-9,11,17H,5-6,10,21H2,(H3,22,23)(H,27,28) |
| InChIKey | KGROCDPYDBHSPF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|