C22H30O3 — CID 57284234
(8R,9R,10R,13S,14S)-4-methoxy-7,10,13-trimethyl-6-methylidene-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57284234) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-4-methoxy-7,10,13-trimethyl-6-methylidene-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9R,10R,13S,14S)-4-methoxy-7,10,13-trimethyl-6-methylidene-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57284234 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (8R,9R,10R,13S,14S)-4-methoxy-7,10,13-trimethyl-6-methylidene-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C=C1C2=C(OC)C(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(=O)CC[C@H]3[C@@H]2C1C |
| InChI | InChI=1S/C22H30O3/c1-12-13(2)19-20(25-5)16(23)9-11-22(19,4)15-8-10-21(3)14(18(12)15)6-7-17(21)24/h12,14-15,18H,2,6-11H2,1,3-5H3/t12?,14-,15+,18-,21-,22+/m0/s1 |
| InChIKey | QCIYMSRABHENOF-OUKLUOJPSA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |