About 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile
5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile (PubChem CID 57284331) has the molecular formula C17H16ClN3O
and a molecular weight of 313.79 g/mol. Its IUPAC name is 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile.
Molecular Properties
| Compound Name | 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile |
| PubChem CID | 57284331 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile |
| SMILES | N#CN1CCCC2(C1)Oc1ccc(Cl)cc1C2n1cccc1 |
| InChI | InChI=1S/C17H16ClN3O/c18-13-4-5-15-14(10-13)16(21-8-1-2-9-21)17(22-15)6-3-7-20(11-17)12-19/h1-2,4-5,8-10,16H,3,6-7,11H2 |
| InChIKey | RUYUFDAEDKSTDV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile?
The IUPAC name of 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile (CID 57284331) is 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile.
What is the SMILES notation for 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile?
The canonical SMILES for 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile is N#CN1CCCC2(C1)Oc1ccc(Cl)cc1C2n1cccc1.
What is the InChIKey of 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile?
The InChIKey is RUYUFDAEDKSTDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O/c18-13-4-5-15-14(10-13)16(21-8-1-2-9-21)17(22-15)6-3-7-20(11-17)12-19/h1-2,4-5,8-10,16H,3,6-7,11H2.
What are the key properties of 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile?
5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile has a molecular weight of 313.79 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-pyrrol-1-ylspiro[3H-1-benzofuran-2,3'-piperidine]-1'-carbonitrile is sourced from PubChem (CID 57284331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).