C15H24F3NO — CID 57284599
4-[2-[2,6-dimethyl-6-(trifluoromethyl)cyclohex-3-en-1-yl]ethyl]morpholine (PubChem CID 57284599) has the molecular formula C15H24F3NO and a molecular weight of 291.36 g/mol. Its IUPAC name is 4-[2-[2,6-dimethyl-6-(trifluoromethyl)cyclohex-3-en-1-yl]ethyl]morpholine.
| Compound Name | 4-[2-[2,6-dimethyl-6-(trifluoromethyl)cyclohex-3-en-1-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 57284599 |
| Molecular Formula | C15H24F3NO |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 4-[2-[2,6-dimethyl-6-(trifluoromethyl)cyclohex-3-en-1-yl]ethyl]morpholine |
| SMILES | CC1C=CCC(C)(C(F)(F)F)C1CCN1CCOCC1 |
| InChI | InChI=1S/C15H24F3NO/c1-12-4-3-6-14(2,15(16,17)18)13(12)5-7-19-8-10-20-11-9-19/h3-4,12-13H,5-11H2,1-2H3 |
| InChIKey | WVKSWHZAGPCIMB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|