C29H31N3O3 — CID 57284779
4-[2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-ethyl-3-oxo-1,3a,4,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile (PubChem CID 57284779) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 4-[2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-ethyl-3-oxo-1,3a,4,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile.
| Compound Name | 4-[2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-ethyl-3-oxo-1,3a,4,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 57284779 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 4-[2-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-1-ethyl-3-oxo-1,3a,4,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
| SMILES | CCC1C2C(C(=O)N1C(Cc1ccccc1)C1=COCO1)C(c1ccc(C#N)cc1)N1CCCC21 |
| InChI | InChI=1S/C29H31N3O3/c1-2-22-26-23-9-6-14-31(23)28(21-12-10-20(16-30)11-13-21)27(26)29(33)32(22)24(25-17-34-18-35-25)15-19-7-4-3-5-8-19/h3-5,7-8,10-13,17,22-24,26-28H,2,6,9,14-15,18H2,1H3 |
| InChIKey | AQVJLTMHYIMRQB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |